C13H11N3S2 — CID 21234014
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1,3-benzothiazole (PubChem CID 21234014) has the molecular formula C13H11N3S2 and a molecular weight of 273.39 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1,3-benzothiazole.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 21234014 |
| Molecular Formula | C13H11N3S2 |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1,3-benzothiazole |
| SMILES | Cc1cc(C)nc(Sc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C13H11N3S2/c1-8-7-9(2)15-12(14-8)18-13-16-10-5-3-4-6-11(10)17-13/h3-7H,1-2H3 |
| InChIKey | JFRQQXFEYPRKOD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |