C14H10ClN3OS2 — CID 107198338
5-amino-2-(1,3-benzothiazol-2-ylsulfanyl)-3-chlorobenzamide (PubChem CID 107198338) has the molecular formula C14H10ClN3OS2 and a molecular weight of 335.84 g/mol. Its IUPAC name is 5-amino-2-(1,3-benzothiazol-2-ylsulfanyl)-3-chlorobenzamide.
| Compound Name | 5-amino-2-(1,3-benzothiazol-2-ylsulfanyl)-3-chlorobenzamide |
|---|---|
| PubChem CID | 107198338 |
| Molecular Formula | C14H10ClN3OS2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 5-amino-2-(1,3-benzothiazol-2-ylsulfanyl)-3-chlorobenzamide |
| SMILES | NC(=O)c1cc(N)cc(Cl)c1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H10ClN3OS2/c15-9-6-7(16)5-8(13(17)19)12(9)21-14-18-10-3-1-2-4-11(10)20-14/h1-6H,16H2,(H2,17,19) |
| InChIKey | FRWNBDIXFLKLLW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|