C14H10N4O6S2 — CID 132802391
azanium 4-(1,3-benzothiazol-2-ylsulfanyl)-3,5-dinitrobenzoate (PubChem CID 132802391) has the molecular formula C14H10N4O6S2 and a molecular weight of 394.39 g/mol. Its IUPAC name is azanium 4-(1,3-benzothiazol-2-ylsulfanyl)-3,5-dinitrobenzoate.
| Compound Name | azanium 4-(1,3-benzothiazol-2-ylsulfanyl)-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 132802391 |
| Molecular Formula | C14H10N4O6S2 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | azanium 4-(1,3-benzothiazol-2-ylsulfanyl)-3,5-dinitrobenzoate |
| SMILES | O=C([O-])c1cc([N+](=O)[O-])c(Sc2nc3ccccc3s2)c([N+](=O)[O-])c1.[NH4+] |
| InChI | InChI=1S/C14H7N3O6S2.H3N/c18-13(19)7-5-9(16(20)21)12(10(6-7)17(22)23)25-14-15-8-3-1-2-4-11(8)24-14;/h1-6H,(H,18,19);1H3 |
| InChIKey | RELKOQZOQHGDCB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 175.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|