C22H13FN2O5S2 — CID 2372454
[2-(4-fluorophenyl)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrobenzoate (PubChem CID 2372454) has the molecular formula C22H13FN2O5S2 and a molecular weight of 468.49 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrobenzoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 2372454 |
| Molecular Formula | C22H13FN2O5S2 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Sc2nc3ccccc3s2)c([N+](=O)[O-])c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H13FN2O5S2/c23-15-8-5-13(6-9-15)18(26)12-30-21(27)14-7-10-20(17(11-14)25(28)29)32-22-24-16-3-1-2-4-19(16)31-22/h1-11H,12H2 |
| InChIKey | BNZCZYBLGIDSAM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 99.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|