C27H25NO5S — CID 4672573
[2-(4-cyclohexylphenyl)-2-oxoethyl] 3-nitro-4-phenylsulfanylbenzoate (PubChem CID 4672573) has the molecular formula C27H25NO5S and a molecular weight of 475.57 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-nitro-4-phenylsulfanylbenzoate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-nitro-4-phenylsulfanylbenzoate |
|---|---|
| PubChem CID | 4672573 |
| Molecular Formula | C27H25NO5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-nitro-4-phenylsulfanylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(Sc2ccccc2)c([N+](=O)[O-])c1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C27H25NO5S/c29-25(21-13-11-20(12-14-21)19-7-3-1-4-8-19)18-33-27(30)22-15-16-26(24(17-22)28(31)32)34-23-9-5-2-6-10-23/h2,5-6,9-17,19H,1,3-4,7-8,18H2 |
| InChIKey | LTEOEECMLKLBLF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|