C23H23NO5 — CID 4291252
[2-(4-cyclohexylphenyl)-2-oxoethyl] 3-(2-nitrophenyl)prop-2-enoate (PubChem CID 4291252) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-(2-nitrophenyl)prop-2-enoate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-(2-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4291252 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-(2-nitrophenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccccc1[N+](=O)[O-])OCC(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H23NO5/c25-22(20-12-10-18(11-13-20)17-6-2-1-3-7-17)16-29-23(26)15-14-19-8-4-5-9-21(19)24(27)28/h4-5,8-15,17H,1-3,6-7,16H2 |
| InChIKey | FBTWBJJRSCNALN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|