C15H16N2O7S — CID 6591172
[2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate (PubChem CID 6591172) has the molecular formula C15H16N2O7S and a molecular weight of 368.37 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6591172 |
| Molecular Formula | C15H16N2O7S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccccc1[N+](=O)[O-])N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H16N2O7S/c18-14(16-12-7-8-25(22,23)10-12)9-24-15(19)6-5-11-3-1-2-4-13(11)17(20)21/h1-6,12H,7-10H2,(H,16,18)/b6-5+/t12-/m0/s1 |
| InChIKey | BVLZUPUTDINQBI-FYJFLYSWSA-N |
| XLogP | 0.45 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|