C11H13N3O4S — CID 51417760
(3S)-N-[(Z)-(2-nitrophenyl)methylideneamino]-1,1-dioxothiolan-3-amine (PubChem CID 51417760) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is (3S)-N-[(Z)-(2-nitrophenyl)methylideneamino]-1,1-dioxothiolan-3-amine.
| Compound Name | (3S)-N-[(Z)-(2-nitrophenyl)methylideneamino]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 51417760 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (3S)-N-[(Z)-(2-nitrophenyl)methylideneamino]-1,1-dioxothiolan-3-amine |
| SMILES | O=[N+]([O-])c1ccccc1/C=N\N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13N3O4S/c15-14(16)11-4-2-1-3-9(11)7-12-13-10-5-6-19(17,18)8-10/h1-4,7,10,13H,5-6,8H2/b12-7-/t10-/m0/s1 |
| InChIKey | CQKZYDOHYRTXRI-BZPKPHBRSA-N |
| XLogP | 0.71 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|