C14H16N2O3S — CID 126797741
N-(2H-chromen-3-ylmethylideneamino)-1,1-dioxothiolan-3-amine (PubChem CID 126797741) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-(2H-chromen-3-ylmethylideneamino)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(2H-chromen-3-ylmethylideneamino)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 126797741 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-(2H-chromen-3-ylmethylideneamino)-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(NN=CC2=Cc3ccccc3OC2)C1 |
| InChI | InChI=1S/C14H16N2O3S/c17-20(18)6-5-13(10-20)16-15-8-11-7-12-3-1-2-4-14(12)19-9-11/h1-4,7-8,13,16H,5-6,9-10H2 |
| InChIKey | FOABMVIXUKDGAS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|