C6H9Cl3N2O2S — CID 40549338
(3R)-1,1-dioxo-N-[(Z)-2,2,2-trichloroethylideneamino]thiolan-3-amine (PubChem CID 40549338) has the molecular formula C6H9Cl3N2O2S and a molecular weight of 279.58 g/mol. Its IUPAC name is (3R)-1,1-dioxo-N-[(Z)-2,2,2-trichloroethylideneamino]thiolan-3-amine.
| Compound Name | (3R)-1,1-dioxo-N-[(Z)-2,2,2-trichloroethylideneamino]thiolan-3-amine |
|---|---|
| PubChem CID | 40549338 |
| Molecular Formula | C6H9Cl3N2O2S |
| Molecular Weight | 279.58 g/mol |
| Exact Mass | 277.95 |
| IUPAC Name | (3R)-1,1-dioxo-N-[(Z)-2,2,2-trichloroethylideneamino]thiolan-3-amine |
| SMILES | O=S1(=O)CC[C@@H](N/N=C\C(Cl)(Cl)Cl)C1 |
| InChI | InChI=1S/C6H9Cl3N2O2S/c7-6(8,9)4-10-11-5-1-2-14(12,13)3-5/h4-5,11H,1-3H2/b10-4-/t5-/m1/s1 |
| InChIKey | ADZINHWRVGNULP-FPJSXXDCSA-N |
| XLogP | 1.12 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.58 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|