C6H11NO3PS+ — CID 175107482
[(1,1-dioxothiolan-3-yl)amino]-ethenyl-oxophosphanium (PubChem CID 175107482) has the molecular formula C6H11NO3PS+ and a molecular weight of 208.20 g/mol. Its IUPAC name is [(1,1-dioxothiolan-3-yl)amino]-ethenyl-oxophosphanium.
| Compound Name | [(1,1-dioxothiolan-3-yl)amino]-ethenyl-oxophosphanium |
|---|---|
| PubChem CID | 175107482 |
| Molecular Formula | C6H11NO3PS+ |
| Molecular Weight | 208.20 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | [(1,1-dioxothiolan-3-yl)amino]-ethenyl-oxophosphanium |
| SMILES | C=C[P+](=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H11NO3PS/c1-2-11(8)7-6-3-4-12(9,10)5-6/h2,6H,1,3-5H2,(H,7,8)/q+1 |
| InChIKey | LSJHMFUYBMKNFK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|