C4H12ClN2O2S+ — CID 155928072
[(1,1-dioxothiolan-3-yl)amino]azanium;hydrochloride (PubChem CID 155928072) has the molecular formula C4H12ClN2O2S+ and a molecular weight of 187.67 g/mol. Its IUPAC name is [(1,1-dioxothiolan-3-yl)amino]azanium;hydrochloride.
| Compound Name | [(1,1-dioxothiolan-3-yl)amino]azanium;hydrochloride |
|---|---|
| PubChem CID | 155928072 |
| Molecular Formula | C4H12ClN2O2S+ |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | [(1,1-dioxothiolan-3-yl)amino]azanium;hydrochloride |
| SMILES | Cl.[NH3+]NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C4H10N2O2S.ClH/c5-6-4-1-2-9(7,8)3-4;/h4,6H,1-3,5H2;1H/p+1 |
| InChIKey | JJAQVUUCQRGKIM-UHFFFAOYSA-O |
| XLogP | -1.66 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|