C10H16ClN7O4S — CID 162223438
3,5-diamino-6-chloro-N-[[(1,1-dioxothiolan-3-yl)hydrazinylidene]methyl]pyrazine-2-carboxamide;hydrate (PubChem CID 162223438) has the molecular formula C10H16ClN7O4S and a molecular weight of 365.80 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[[(1,1-dioxothiolan-3-yl)hydrazinylidene]methyl]pyrazine-2-carboxamide;hydrate.
| Compound Name | 3,5-diamino-6-chloro-N-[[(1,1-dioxothiolan-3-yl)hydrazinylidene]methyl]pyrazine-2-carboxamide;hydrate |
|---|---|
| PubChem CID | 162223438 |
| Molecular Formula | C10H16ClN7O4S |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[[(1,1-dioxothiolan-3-yl)hydrazinylidene]methyl]pyrazine-2-carboxamide;hydrate |
| SMILES | Nc1nc(N)c(C(=O)NC=NNC2CCS(=O)(=O)C2)nc1Cl.O |
| InChI | InChI=1S/C10H14ClN7O3S.H2O/c11-7-9(13)17-8(12)6(16-7)10(19)14-4-15-18-5-1-2-22(20,21)3-5;/h4-5,18H,1-3H2,(H4,12,13,17)(H,14,15,19);1H2 |
| InChIKey | ZULAWPWZPUHKNH-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 196.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|