C40H54ClN8O9S2+ — CID 137440362
3,5-diamino-N-[(3S)-1,1-bis[3-[4-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide (PubChem CID 137440362) has the molecular formula C40H54ClN8O9S2+ and a molecular weight of 890.51 g/mol. Its IUPAC name is 3,5-diamino-N-[(3S)-1,1-bis[3-[4-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[(3S)-1,1-bis[3-[4-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 137440362 |
| Molecular Formula | C40H54ClN8O9S2+ |
| Molecular Weight | 890.51 g/mol |
| Exact Mass | 889.31 |
| IUPAC Name | 3,5-diamino-N-[(3S)-1,1-bis[3-[4-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide |
| SMILES | Nc1nc(N)c(C(=O)N[C@H]2CCC[N+](CCCc3ccc(OCC(=O)NC4CCS(=O)(=O)C4)cc3)(CCCc3ccc(OCC(=O)NC4CCS(=O)(=O)C4)cc3)C2)nc1Cl |
| InChI | InChI=1S/C40H53ClN8O9S2/c41-37-39(43)48-38(42)36(47-37)40(52)46-29-6-3-19-49(22-29,17-1-4-27-7-11-32(12-8-27)57-23-34(50)44-30-15-20-59(53,54)25-30)18-2-5-28-9-13-33(14-10-28)58-24-35(51)45-31-16-21-60(55,56)26-31/h7-14,29-31H,1-6,15-26H2,(H6-,42,43,44,45,46,48,50,51,52)/p+1/t29-,30?,31?,49?/m0/s1 |
| InChIKey | WYJYOZCEDRZYSD-YCTNLNLBSA-O |
| XLogP | 1.63 |
| TPSA | 251.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|