C42H60Cl2N6O7 — CID 158354137
3,5-diamino-N-[(3S)-1,1-bis[3-[4-(6-methoxy-2-oxohexoxy)phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide chloride (PubChem CID 158354137) has the molecular formula C42H60Cl2N6O7 and a molecular weight of 831.88 g/mol. Its IUPAC name is 3,5-diamino-N-[(3S)-1,1-bis[3-[4-(6-methoxy-2-oxohexoxy)phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide chloride.
| Compound Name | 3,5-diamino-N-[(3S)-1,1-bis[3-[4-(6-methoxy-2-oxohexoxy)phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide chloride |
|---|---|
| PubChem CID | 158354137 |
| Molecular Formula | C42H60Cl2N6O7 |
| Molecular Weight | 831.88 g/mol |
| Exact Mass | 830.39 |
| IUPAC Name | 3,5-diamino-N-[(3S)-1,1-bis[3-[4-(6-methoxy-2-oxohexoxy)phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide chloride |
| SMILES | COCCCCC(=O)COc1ccc(CCC[N+]2(CCCc3ccc(OCC(=O)CCCCOC)cc3)CCC[C@H](NC(=O)c3nc(Cl)c(N)nc3N)C2)cc1.[Cl-] |
| InChI | InChI=1S/C42H59ClN6O7.ClH/c1-53-26-5-3-13-34(50)29-55-36-19-15-31(16-20-36)10-7-23-49(25-9-12-33(28-49)46-42(52)38-40(44)48-41(45)39(43)47-38)24-8-11-32-17-21-37(22-18-32)56-30-35(51)14-4-6-27-54-2;/h15-22,33H,3-14,23-30H2,1-2H3,(H4-,44,45,46,48,52);1H/t33-;/m0./s1 |
| InChIKey | QQEGAWRHGJUTAE-WAQYZQTGSA-N |
| XLogP | 2.80 |
| TPSA | 177.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.88 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|