C42H60Cl2N6O9 — CID 158092749
3,5-diamino-N-[(3S)-1,1-bis[3-[4-[5-(2-hydroxyethoxy)-2-oxopentoxy]phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide chloride (PubChem CID 158092749) has the molecular formula C42H60Cl2N6O9 and a molecular weight of 863.88 g/mol. Its IUPAC name is 3,5-diamino-N-[(3S)-1,1-bis[3-[4-[5-(2-hydroxyethoxy)-2-oxopentoxy]phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide chloride.
| Compound Name | 3,5-diamino-N-[(3S)-1,1-bis[3-[4-[5-(2-hydroxyethoxy)-2-oxopentoxy]phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide chloride |
|---|---|
| PubChem CID | 158092749 |
| Molecular Formula | C42H60Cl2N6O9 |
| Molecular Weight | 863.88 g/mol |
| Exact Mass | 862.38 |
| IUPAC Name | 3,5-diamino-N-[(3S)-1,1-bis[3-[4-[5-(2-hydroxyethoxy)-2-oxopentoxy]phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide chloride |
| SMILES | Nc1nc(N)c(C(=O)N[C@H]2CCC[N+](CCCc3ccc(OCC(=O)CCCOCCO)cc3)(CCCc3ccc(OCC(=O)CCCOCCO)cc3)C2)nc1Cl.[Cl-] |
| InChI | InChI=1S/C42H59ClN6O9.ClH/c43-39-41(45)48-40(44)38(47-39)42(54)46-33-8-3-21-49(28-33,19-1-6-31-11-15-36(16-12-31)57-29-34(52)9-4-24-55-26-22-50)20-2-7-32-13-17-37(18-14-32)58-30-35(53)10-5-25-56-27-23-51;/h11-18,33,50-51H,1-10,19-30H2,(H4-,44,45,46,48,54);1H/t33-;/m0./s1 |
| InChIKey | SKIPIMGFIFZVNJ-WAQYZQTGSA-N |
| XLogP | 0.75 |
| TPSA | 218.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.88 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|