C6H9Cl2N7O — CID 135568542
3,5-diamino-6-chloro-N-[(E)-hydrazinylidenemethyl]pyrazine-2-carboxamide;hydrochloride (PubChem CID 135568542) has the molecular formula C6H9Cl2N7O and a molecular weight of 266.09 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[(E)-hydrazinylidenemethyl]pyrazine-2-carboxamide;hydrochloride.
| Compound Name | 3,5-diamino-6-chloro-N-[(E)-hydrazinylidenemethyl]pyrazine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 135568542 |
| Molecular Formula | C6H9Cl2N7O |
| Molecular Weight | 266.09 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[(E)-hydrazinylidenemethyl]pyrazine-2-carboxamide;hydrochloride |
| SMILES | Cl.N/N=C/NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C6H8ClN7O.ClH/c7-3-5(9)14-4(8)2(13-3)6(15)11-1-12-10;/h1H,10H2,(H4,8,9,14)(H,11,12,15);1H |
| InChIKey | AKTBIKVBWLLDEP-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.09 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|