C8H13BrClN7O2 — CID 162336366
3,5-diamino-6-chloro-N-[N'-(2-hydroxyethyl)carbamimidoyl]pyrazine-2-carboxamide;hydrobromide (PubChem CID 162336366) has the molecular formula C8H13BrClN7O2 and a molecular weight of 354.60 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-(2-hydroxyethyl)carbamimidoyl]pyrazine-2-carboxamide;hydrobromide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-(2-hydroxyethyl)carbamimidoyl]pyrazine-2-carboxamide;hydrobromide |
|---|---|
| PubChem CID | 162336366 |
| Molecular Formula | C8H13BrClN7O2 |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-(2-hydroxyethyl)carbamimidoyl]pyrazine-2-carboxamide;hydrobromide |
| SMILES | Br.N/C(=N\CCO)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C8H12ClN7O2.BrH/c9-4-6(11)15-5(10)3(14-4)7(18)16-8(12)13-1-2-17;/h17H,1-2H2,(H4,10,11,15)(H3,12,13,16,18);1H |
| InChIKey | BYXMGSVPFXTTGY-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|