C9H13Cl2N7O3 — CID 57396266
3-[[6-amino-3-chloro-5-(diaminomethylidenecarbamoyl)pyrazin-2-yl]amino]propanoic acid;hydrochloride (PubChem CID 57396266) has the molecular formula C9H13Cl2N7O3 and a molecular weight of 338.16 g/mol. Its IUPAC name is 3-[[6-amino-3-chloro-5-(diaminomethylidenecarbamoyl)pyrazin-2-yl]amino]propanoic acid;hydrochloride.
| Compound Name | 3-[[6-amino-3-chloro-5-(diaminomethylidenecarbamoyl)pyrazin-2-yl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 57396266 |
| Molecular Formula | C9H13Cl2N7O3 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 3-[[6-amino-3-chloro-5-(diaminomethylidenecarbamoyl)pyrazin-2-yl]amino]propanoic acid;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1nc(Cl)c(NCCC(=O)O)nc1N |
| InChI | InChI=1S/C9H12ClN7O3.ClH/c10-5-7(14-2-1-3(18)19)16-6(11)4(15-5)8(20)17-9(12)13;/h1-2H2,(H,18,19)(H3,11,14,16)(H4,12,13,17,20);1H |
| InChIKey | BSWNGPWPLGDTNW-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 182.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|