C22H22N8O — CID 165417092
3-amino-N-(diaminomethylidene)-5-[2-(1H-indol-3-yl)ethylamino]-6-phenylpyrazine-2-carboxamide (PubChem CID 165417092) has the molecular formula C22H22N8O and a molecular weight of 414.47 g/mol. Its IUPAC name is 3-amino-N-(diaminomethylidene)-5-[2-(1H-indol-3-yl)ethylamino]-6-phenylpyrazine-2-carboxamide.
| Compound Name | 3-amino-N-(diaminomethylidene)-5-[2-(1H-indol-3-yl)ethylamino]-6-phenylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 165417092 |
| Molecular Formula | C22H22N8O |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-amino-N-(diaminomethylidene)-5-[2-(1H-indol-3-yl)ethylamino]-6-phenylpyrazine-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1nc(-c2ccccc2)c(NCCc2c[nH]c3ccccc23)nc1N |
| InChI | InChI=1S/C22H22N8O/c23-19-18(21(31)30-22(24)25)28-17(13-6-2-1-3-7-13)20(29-19)26-11-10-14-12-27-16-9-5-4-8-15(14)16/h1-9,12,27H,10-11H2,(H3,23,26,29)(H4,24,25,30,31) |
| InChIKey | BQRZELSKWDNKRT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 161.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|