C23H25ClN8O — CID 169205866
3-amino-N-(diaminomethylidene)-5-[2-(1H-indol-3-yl)ethylamino]-6-(4-methylphenyl)pyrazine-2-carboxamide;hydrochloride (PubChem CID 169205866) has the molecular formula C23H25ClN8O and a molecular weight of 464.96 g/mol. Its IUPAC name is 3-amino-N-(diaminomethylidene)-5-[2-(1H-indol-3-yl)ethylamino]-6-(4-methylphenyl)pyrazine-2-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-(diaminomethylidene)-5-[2-(1H-indol-3-yl)ethylamino]-6-(4-methylphenyl)pyrazine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 169205866 |
| Molecular Formula | C23H25ClN8O |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 3-amino-N-(diaminomethylidene)-5-[2-(1H-indol-3-yl)ethylamino]-6-(4-methylphenyl)pyrazine-2-carboxamide;hydrochloride |
| SMILES | Cc1ccc(-c2nc(C(=O)N=C(N)N)c(N)nc2NCCc2c[nH]c3ccccc23)cc1.Cl |
| InChI | InChI=1S/C23H24N8O.ClH/c1-13-6-8-14(9-7-13)18-21(30-20(24)19(29-18)22(32)31-23(25)26)27-11-10-15-12-28-17-5-3-2-4-16(15)17;/h2-9,12,28H,10-11H2,1H3,(H3,24,27,30)(H4,25,26,31,32);1H |
| InChIKey | ZTBDQHNFNQYHDU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 161.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|