C21H21N9O — CID 169205815
3-amino-N-(diaminomethylidene)-5-[2-(1H-indol-3-yl)ethylamino]-6-pyridin-4-ylpyrazine-2-carboxamide (PubChem CID 169205815) has the molecular formula C21H21N9O and a molecular weight of 415.46 g/mol. Its IUPAC name is 3-amino-N-(diaminomethylidene)-5-[2-(1H-indol-3-yl)ethylamino]-6-pyridin-4-ylpyrazine-2-carboxamide.
| Compound Name | 3-amino-N-(diaminomethylidene)-5-[2-(1H-indol-3-yl)ethylamino]-6-pyridin-4-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 169205815 |
| Molecular Formula | C21H21N9O |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 3-amino-N-(diaminomethylidene)-5-[2-(1H-indol-3-yl)ethylamino]-6-pyridin-4-ylpyrazine-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1nc(-c2ccncc2)c(NCCc2c[nH]c3ccccc23)nc1N |
| InChI | InChI=1S/C21H21N9O/c22-18-17(20(31)30-21(23)24)28-16(12-5-8-25-9-6-12)19(29-18)26-10-7-13-11-27-15-4-2-1-3-14(13)15/h1-6,8-9,11,27H,7,10H2,(H3,22,26,29)(H4,23,24,30,31) |
| InChIKey | ZKYOXSQPEOZWHD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|