C17H22ClN5O — CID 87387992
3-amino-N-benzyl-6-chloro-5-(3-methylbutylamino)pyrazine-2-carboxamide (PubChem CID 87387992) has the molecular formula C17H22ClN5O and a molecular weight of 347.85 g/mol. Its IUPAC name is 3-amino-N-benzyl-6-chloro-5-(3-methylbutylamino)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-benzyl-6-chloro-5-(3-methylbutylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 87387992 |
| Molecular Formula | C17H22ClN5O |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 3-amino-N-benzyl-6-chloro-5-(3-methylbutylamino)pyrazine-2-carboxamide |
| SMILES | CC(C)CCNc1nc(N)c(C(=O)NCc2ccccc2)nc1Cl |
| InChI | InChI=1S/C17H22ClN5O/c1-11(2)8-9-20-16-14(18)22-13(15(19)23-16)17(24)21-10-12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3,(H,21,24)(H3,19,20,23) |
| InChIKey | HRZZRNPTIOAVIQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |