C13H8Cl4N2O — CID 628678
N-benzyl-2,4,5,6-tetrachloropyridine-3-carboxamide (PubChem CID 628678) has the molecular formula C13H8Cl4N2O and a molecular weight of 350.03 g/mol. Its IUPAC name is N-benzyl-2,4,5,6-tetrachloropyridine-3-carboxamide.
| Compound Name | N-benzyl-2,4,5,6-tetrachloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 628678 |
| Molecular Formula | C13H8Cl4N2O |
| Molecular Weight | 350.03 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | N-benzyl-2,4,5,6-tetrachloropyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1c(Cl)nc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H8Cl4N2O/c14-9-8(11(16)19-12(17)10(9)15)13(20)18-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,18,20) |
| InChIKey | MAKAUYWKQYUZPW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.03 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|