C23H15Cl3N2OS — CID 108738492
2,3,6-trichloro-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzamide (PubChem CID 108738492) has the molecular formula C23H15Cl3N2OS and a molecular weight of 473.81 g/mol. Its IUPAC name is 2,3,6-trichloro-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzamide.
| Compound Name | 2,3,6-trichloro-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 108738492 |
| Molecular Formula | C23H15Cl3N2OS |
| Molecular Weight | 473.81 g/mol |
| Exact Mass | 472.00 |
| IUPAC Name | 2,3,6-trichloro-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(-c2nc(-c3ccccc3)cs2)c1)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C23H15Cl3N2OS/c24-17-9-10-18(25)21(26)20(17)22(29)27-12-14-5-4-8-16(11-14)23-28-19(13-30-23)15-6-2-1-3-7-15/h1-11,13H,12H2,(H,27,29) |
| InChIKey | ILEQQFLXWNXIJF-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.81 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|