C21H21ClN4OS — CID 15979683
N-benzyl-4-chloro-2-methylsulfanyl-6-(2-phenylethylamino)pyrimidine-5-carboxamide (PubChem CID 15979683) has the molecular formula C21H21ClN4OS and a molecular weight of 412.95 g/mol. Its IUPAC name is N-benzyl-4-chloro-2-methylsulfanyl-6-(2-phenylethylamino)pyrimidine-5-carboxamide.
| Compound Name | N-benzyl-4-chloro-2-methylsulfanyl-6-(2-phenylethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 15979683 |
| Molecular Formula | C21H21ClN4OS |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-benzyl-4-chloro-2-methylsulfanyl-6-(2-phenylethylamino)pyrimidine-5-carboxamide |
| SMILES | CSc1nc(Cl)c(C(=O)NCc2ccccc2)c(NCCc2ccccc2)n1 |
| InChI | InChI=1S/C21H21ClN4OS/c1-28-21-25-18(22)17(20(27)24-14-16-10-6-3-7-11-16)19(26-21)23-13-12-15-8-4-2-5-9-15/h2-11H,12-14H2,1H3,(H,24,27)(H,23,25,26) |
| InChIKey | OXVJZXVPNVZZFM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |