C21H22N4OS2 — CID 15979333
4-(benzylamino)-6-benzylsulfanyl-N-methyl-2-methylsulfanylpyrimidine-5-carboxamide (PubChem CID 15979333) has the molecular formula C21H22N4OS2 and a molecular weight of 410.57 g/mol. Its IUPAC name is 4-(benzylamino)-6-benzylsulfanyl-N-methyl-2-methylsulfanylpyrimidine-5-carboxamide.
| Compound Name | 4-(benzylamino)-6-benzylsulfanyl-N-methyl-2-methylsulfanylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 15979333 |
| Molecular Formula | C21H22N4OS2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 4-(benzylamino)-6-benzylsulfanyl-N-methyl-2-methylsulfanylpyrimidine-5-carboxamide |
| SMILES | CNC(=O)c1c(NCc2ccccc2)nc(SC)nc1SCc1ccccc1 |
| InChI | InChI=1S/C21H22N4OS2/c1-22-19(26)17-18(23-13-15-9-5-3-6-10-15)24-21(27-2)25-20(17)28-14-16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3,(H,22,26)(H,23,24,25) |
| InChIKey | YENLLXXRYYROIU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |