C26H22N4S — CID 2767509
4-(benzylamino)-2-benzylsulfanyl-6-(4-methylphenyl)pyrimidine-5-carbonitrile (PubChem CID 2767509) has the molecular formula C26H22N4S and a molecular weight of 422.56 g/mol. Its IUPAC name is 4-(benzylamino)-2-benzylsulfanyl-6-(4-methylphenyl)pyrimidine-5-carbonitrile.
| Compound Name | 4-(benzylamino)-2-benzylsulfanyl-6-(4-methylphenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 2767509 |
| Molecular Formula | C26H22N4S |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 4-(benzylamino)-2-benzylsulfanyl-6-(4-methylphenyl)pyrimidine-5-carbonitrile |
| SMILES | Cc1ccc(-c2nc(SCc3ccccc3)nc(NCc3ccccc3)c2C#N)cc1 |
| InChI | InChI=1S/C26H22N4S/c1-19-12-14-22(15-13-19)24-23(16-27)25(28-17-20-8-4-2-5-9-20)30-26(29-24)31-18-21-10-6-3-7-11-21/h2-15H,17-18H2,1H3,(H,28,29,30) |
| InChIKey | VZKDOYOKLVCJIV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |