C21H20N4S — CID 167713852
4-anilino-2-(2-methylpropylsulfanyl)-6-phenylpyrimidine-5-carbonitrile (PubChem CID 167713852) has the molecular formula C21H20N4S and a molecular weight of 360.49 g/mol. Its IUPAC name is 4-anilino-2-(2-methylpropylsulfanyl)-6-phenylpyrimidine-5-carbonitrile.
| Compound Name | 4-anilino-2-(2-methylpropylsulfanyl)-6-phenylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 167713852 |
| Molecular Formula | C21H20N4S |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-anilino-2-(2-methylpropylsulfanyl)-6-phenylpyrimidine-5-carbonitrile |
| SMILES | CC(C)CSc1nc(Nc2ccccc2)c(C#N)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H20N4S/c1-15(2)14-26-21-24-19(16-9-5-3-6-10-16)18(13-22)20(25-21)23-17-11-7-4-8-12-17/h3-12,15H,14H2,1-2H3,(H,23,24,25) |
| InChIKey | KEYTUAKAGIFPJS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |