C20H13N5O2S — CID 118733311
4-(4-nitroanilino)-6-phenyl-2-prop-2-ynylsulfanylpyrimidine-5-carbonitrile (PubChem CID 118733311) has the molecular formula C20H13N5O2S and a molecular weight of 387.42 g/mol. Its IUPAC name is 4-(4-nitroanilino)-6-phenyl-2-prop-2-ynylsulfanylpyrimidine-5-carbonitrile.
| Compound Name | 4-(4-nitroanilino)-6-phenyl-2-prop-2-ynylsulfanylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 118733311 |
| Molecular Formula | C20H13N5O2S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 4-(4-nitroanilino)-6-phenyl-2-prop-2-ynylsulfanylpyrimidine-5-carbonitrile |
| SMILES | C#CCSc1nc(Nc2ccc([N+](=O)[O-])cc2)c(C#N)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H13N5O2S/c1-2-12-28-20-23-18(14-6-4-3-5-7-14)17(13-21)19(24-20)22-15-8-10-16(11-9-15)25(26)27/h1,3-11H,12H2,(H,22,23,24) |
| InChIKey | GNKZFMHOEIVNFR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|