C16H18N6OS — CID 162639331
[[5-cyano-2-(2-methylpropylsulfanyl)-6-phenylpyrimidin-4-yl]amino]urea (PubChem CID 162639331) has the molecular formula C16H18N6OS and a molecular weight of 342.43 g/mol. Its IUPAC name is [[5-cyano-2-(2-methylpropylsulfanyl)-6-phenylpyrimidin-4-yl]amino]urea.
| Compound Name | [[5-cyano-2-(2-methylpropylsulfanyl)-6-phenylpyrimidin-4-yl]amino]urea |
|---|---|
| PubChem CID | 162639331 |
| Molecular Formula | C16H18N6OS |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [[5-cyano-2-(2-methylpropylsulfanyl)-6-phenylpyrimidin-4-yl]amino]urea |
| SMILES | CC(C)CSc1nc(NNC(N)=O)c(C#N)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H18N6OS/c1-10(2)9-24-16-19-13(11-6-4-3-5-7-11)12(8-17)14(20-16)21-22-15(18)23/h3-7,10H,9H2,1-2H3,(H3,18,22,23)(H,19,20,21) |
| InChIKey | KMCRLJILAQDUSQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|