C22H19ClFN5OS — CID 175667675
4-[(2E)-2-[(5-chloro-2-hydroxyphenyl)methylidene]hydrazinyl]-6-(4-fluorophenyl)-2-(2-methylpropylsulfanyl)pyrimidine-5-carbonitrile (PubChem CID 175667675) has the molecular formula C22H19ClFN5OS and a molecular weight of 455.95 g/mol. Its IUPAC name is 4-[(2E)-2-[(5-chloro-2-hydroxyphenyl)methylidene]hydrazinyl]-6-(4-fluorophenyl)-2-(2-methylpropylsulfanyl)pyrimidine-5-carbonitrile.
| Compound Name | 4-[(2E)-2-[(5-chloro-2-hydroxyphenyl)methylidene]hydrazinyl]-6-(4-fluorophenyl)-2-(2-methylpropylsulfanyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 175667675 |
| Molecular Formula | C22H19ClFN5OS |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 4-[(2E)-2-[(5-chloro-2-hydroxyphenyl)methylidene]hydrazinyl]-6-(4-fluorophenyl)-2-(2-methylpropylsulfanyl)pyrimidine-5-carbonitrile |
| SMILES | CC(C)CSc1nc(N/N=C/c2cc(Cl)ccc2O)c(C#N)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H19ClFN5OS/c1-13(2)12-31-22-27-20(14-3-6-17(24)7-4-14)18(10-25)21(28-22)29-26-11-15-9-16(23)5-8-19(15)30/h3-9,11,13,30H,12H2,1-2H3,(H,27,28,29)/b26-11+ |
| InChIKey | YOMQLAUBKSMCRY-KBKYJPHKSA-N |
| XLogP | 5.71 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|