C8H7ClN6O — CID 135684788
4-chloro-2-[(E)-(2H-tetrazol-5-ylhydrazinylidene)methyl]phenol (PubChem CID 135684788) has the molecular formula C8H7ClN6O and a molecular weight of 238.64 g/mol. Its IUPAC name is 4-chloro-2-[(E)-(2H-tetrazol-5-ylhydrazinylidene)methyl]phenol.
| Compound Name | 4-chloro-2-[(E)-(2H-tetrazol-5-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 135684788 |
| Molecular Formula | C8H7ClN6O |
| Molecular Weight | 238.64 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 4-chloro-2-[(E)-(2H-tetrazol-5-ylhydrazinylidene)methyl]phenol |
| SMILES | Oc1ccc(Cl)cc1/C=N/Nc1nn[nH]n1 |
| InChI | InChI=1S/C8H7ClN6O/c9-6-1-2-7(16)5(3-6)4-10-11-8-12-14-15-13-8/h1-4,16H,(H2,11,12,13,14,15)/b10-4+ |
| InChIKey | VJFSCMPVCARPJJ-ONNFQVAWSA-N |
| XLogP | 1.00 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.64 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|