C8H7ClN6 — CID 7188525
N-[(Z)-(4-chlorophenyl)methylideneamino]-2H-tetrazol-5-amine (PubChem CID 7188525) has the molecular formula C8H7ClN6 and a molecular weight of 222.64 g/mol. Its IUPAC name is N-[(Z)-(4-chlorophenyl)methylideneamino]-2H-tetrazol-5-amine.
| Compound Name | N-[(Z)-(4-chlorophenyl)methylideneamino]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 7188525 |
| Molecular Formula | C8H7ClN6 |
| Molecular Weight | 222.64 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | N-[(Z)-(4-chlorophenyl)methylideneamino]-2H-tetrazol-5-amine |
| SMILES | Clc1ccc(/C=N\Nc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C8H7ClN6/c9-7-3-1-6(2-4-7)5-10-11-8-12-14-15-13-8/h1-5H,(H2,11,12,13,14,15)/b10-5- |
| InChIKey | SZFUMFNPTAQHAI-YHYXMXQVSA-N |
| XLogP | 1.30 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.64 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|