C8H8ClN5 — CID 961582
N-[(4-chlorophenyl)methyl]-2H-tetrazol-5-amine (PubChem CID 961582) has the molecular formula C8H8ClN5 and a molecular weight of 209.64 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2H-tetrazol-5-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 961582 |
| Molecular Formula | C8H8ClN5 |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2H-tetrazol-5-amine |
| SMILES | Clc1ccc(CNc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C8H8ClN5/c9-7-3-1-6(2-4-7)5-10-8-11-13-14-12-8/h1-4H,5H2,(H2,10,11,12,13,14) |
| InChIKey | UEUBXINKLHLJJM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |