C14H16Cl4N2 — CID 20519808
1,2-bis[(4-chlorophenyl)methyl]hydrazine;dihydrochloride (PubChem CID 20519808) has the molecular formula C14H16Cl4N2 and a molecular weight of 354.11 g/mol. Its IUPAC name is 1,2-bis[(4-chlorophenyl)methyl]hydrazine;dihydrochloride.
| Compound Name | 1,2-bis[(4-chlorophenyl)methyl]hydrazine;dihydrochloride |
|---|---|
| PubChem CID | 20519808 |
| Molecular Formula | C14H16Cl4N2 |
| Molecular Weight | 354.11 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 1,2-bis[(4-chlorophenyl)methyl]hydrazine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccc(CNNCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H14Cl2N2.2ClH/c15-13-5-1-11(2-6-13)9-17-18-10-12-3-7-14(16)8-4-12;;/h1-8,17-18H,9-10H2;2*1H |
| InChIKey | GDEFXBGGXGAPIZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.11 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|