C7H6ClN5O2S — CID 25048371
4-chloro-N-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 25048371) has the molecular formula C7H6ClN5O2S and a molecular weight of 259.68 g/mol. Its IUPAC name is 4-chloro-N-(2H-tetrazol-5-yl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(2H-tetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 25048371 |
| Molecular Formula | C7H6ClN5O2S |
| Molecular Weight | 259.68 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 4-chloro-N-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nn[nH]n1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H6ClN5O2S/c8-5-1-3-6(4-2-5)16(14,15)11-7-9-12-13-10-7/h1-4H,(H2,9,10,11,12,13) |
| InChIKey | ITYMHBCBMMKPAA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.68 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |