C10H13N5 — CID 961500
N-[(4-ethylphenyl)methyl]-2H-tetrazol-5-amine (PubChem CID 961500) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is N-[(4-ethylphenyl)methyl]-2H-tetrazol-5-amine.
| Compound Name | N-[(4-ethylphenyl)methyl]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 961500 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | N-[(4-ethylphenyl)methyl]-2H-tetrazol-5-amine |
| SMILES | CCc1ccc(CNc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C10H13N5/c1-2-8-3-5-9(6-4-8)7-11-10-12-14-15-13-10/h3-6H,2,7H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | NUAAMCKPBHDTJY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |