C13H15N3 — CID 106900112
N-[(4-ethylphenyl)methyl]pyrimidin-4-amine (PubChem CID 106900112) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-[(4-ethylphenyl)methyl]pyrimidin-4-amine.
| Compound Name | N-[(4-ethylphenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106900112 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-[(4-ethylphenyl)methyl]pyrimidin-4-amine |
| SMILES | CCc1ccc(CNc2ccncn2)cc1 |
| InChI | InChI=1S/C13H15N3/c1-2-11-3-5-12(6-4-11)9-15-13-7-8-14-10-16-13/h3-8,10H,2,9H2,1H3,(H,14,15,16) |
| InChIKey | UPHUCJODAQQWEP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |