C11H10BrN3 — CID 61401223
N-[(3-bromophenyl)methyl]pyrimidin-4-amine (PubChem CID 61401223) has the molecular formula C11H10BrN3 and a molecular weight of 264.13 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]pyrimidin-4-amine.
| Compound Name | N-[(3-bromophenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 61401223 |
| Molecular Formula | C11H10BrN3 |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | N-[(3-bromophenyl)methyl]pyrimidin-4-amine |
| SMILES | Brc1cccc(CNc2ccncn2)c1 |
| InChI | InChI=1S/C11H10BrN3/c12-10-3-1-2-9(6-10)7-14-11-4-5-13-8-15-11/h1-6,8H,7H2,(H,13,14,15) |
| InChIKey | BDGDRTNZMIZGTB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |