C12H12BrN3O — CID 66327634
N-[(3-bromophenyl)methyl]-6-methoxypyrimidin-4-amine (PubChem CID 66327634) has the molecular formula C12H12BrN3O and a molecular weight of 294.15 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-6-methoxypyrimidin-4-amine.
| Compound Name | N-[(3-bromophenyl)methyl]-6-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 66327634 |
| Molecular Formula | C12H12BrN3O |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-6-methoxypyrimidin-4-amine |
| SMILES | COc1cc(NCc2cccc(Br)c2)ncn1 |
| InChI | InChI=1S/C12H12BrN3O/c1-17-12-6-11(15-8-16-12)14-7-9-3-2-4-10(13)5-9/h2-6,8H,7H2,1H3,(H,14,15,16) |
| InChIKey | OCGPXQXQXVASKS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |