C11H12BrN5 — CID 80899114
N-[(3-bromophenyl)methyl]-2-hydrazinylpyrimidin-4-amine (PubChem CID 80899114) has the molecular formula C11H12BrN5 and a molecular weight of 294.16 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2-hydrazinylpyrimidin-4-amine.
| Compound Name | N-[(3-bromophenyl)methyl]-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80899114 |
| Molecular Formula | C11H12BrN5 |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1nccc(NCc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C11H12BrN5/c12-9-3-1-2-8(6-9)7-15-10-4-5-14-11(16-10)17-13/h1-6H,7,13H2,(H2,14,15,16,17) |
| InChIKey | XSXIGQYDKPOSHN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|