C10H12N6 — CID 80944833
2-hydrazinyl-N-(pyridin-3-ylmethyl)pyrimidin-4-amine (PubChem CID 80944833) has the molecular formula C10H12N6 and a molecular weight of 216.25 g/mol. Its IUPAC name is 2-hydrazinyl-N-(pyridin-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80944833 |
| Molecular Formula | C10H12N6 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-hydrazinyl-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
| SMILES | NNc1nccc(NCc2cccnc2)n1 |
| InChI | InChI=1S/C10H12N6/c11-16-10-13-5-3-9(15-10)14-7-8-2-1-4-12-6-8/h1-6H,7,11H2,(H2,13,14,15,16) |
| InChIKey | QGPUYTOGCIOIGA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|