C10H9ClN4 — CID 82676696
4-chloro-N-(pyridin-3-ylmethyl)pyrimidin-2-amine (PubChem CID 82676696) has the molecular formula C10H9ClN4 and a molecular weight of 220.66 g/mol. Its IUPAC name is 4-chloro-N-(pyridin-3-ylmethyl)pyrimidin-2-amine.
| Compound Name | 4-chloro-N-(pyridin-3-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 82676696 |
| Molecular Formula | C10H9ClN4 |
| Molecular Weight | 220.66 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 4-chloro-N-(pyridin-3-ylmethyl)pyrimidin-2-amine |
| SMILES | Clc1ccnc(NCc2cccnc2)n1 |
| InChI | InChI=1S/C10H9ClN4/c11-9-3-5-13-10(15-9)14-7-8-2-1-4-12-6-8/h1-6H,7H2,(H,13,14,15) |
| InChIKey | SAKPXXFGOCZGRC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.66 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |