C11H10ClN3 — CID 61252594
N-[(4-chlorophenyl)methyl]pyrimidin-4-amine (PubChem CID 61252594) has the molecular formula C11H10ClN3 and a molecular weight of 219.68 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]pyrimidin-4-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 61252594 |
| Molecular Formula | C11H10ClN3 |
| Molecular Weight | 219.68 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]pyrimidin-4-amine |
| SMILES | Clc1ccc(CNc2ccncn2)cc1 |
| InChI | InChI=1S/C11H10ClN3/c12-10-3-1-9(2-4-10)7-14-11-5-6-13-8-15-11/h1-6,8H,7H2,(H,13,14,15) |
| InChIKey | XYZILPXMYPEXHV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.68 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |