C18H15Cl2N3O — CID 134116375
6-[(4-chlorophenyl)methoxy]-N-[(4-chlorophenyl)methyl]pyrimidin-4-amine (PubChem CID 134116375) has the molecular formula C18H15Cl2N3O and a molecular weight of 360.24 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methoxy]-N-[(4-chlorophenyl)methyl]pyrimidin-4-amine.
| Compound Name | 6-[(4-chlorophenyl)methoxy]-N-[(4-chlorophenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 134116375 |
| Molecular Formula | C18H15Cl2N3O |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 6-[(4-chlorophenyl)methoxy]-N-[(4-chlorophenyl)methyl]pyrimidin-4-amine |
| SMILES | Clc1ccc(CNc2cc(OCc3ccc(Cl)cc3)ncn2)cc1 |
| InChI | InChI=1S/C18H15Cl2N3O/c19-15-5-1-13(2-6-15)10-21-17-9-18(23-12-22-17)24-11-14-3-7-16(20)8-4-14/h1-9,12H,10-11H2,(H,21,22,23) |
| InChIKey | HXORWJDWGYXLRK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |