C5H6N6O — CID 164660602
N-(1,2-oxazol-3-ylmethyl)-2H-tetrazol-5-amine (PubChem CID 164660602) has the molecular formula C5H6N6O and a molecular weight of 166.14 g/mol. Its IUPAC name is N-(1,2-oxazol-3-ylmethyl)-2H-tetrazol-5-amine.
| Compound Name | N-(1,2-oxazol-3-ylmethyl)-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 164660602 |
| Molecular Formula | C5H6N6O |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | N-(1,2-oxazol-3-ylmethyl)-2H-tetrazol-5-amine |
| SMILES | c1cc(CNc2nn[nH]n2)no1 |
| InChI | InChI=1S/C5H6N6O/c1-2-12-9-4(1)3-6-5-7-10-11-8-5/h1-2H,3H2,(H2,6,7,8,10,11) |
| InChIKey | ZBLDRSVOZGCNIT-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |