C8H6Br2N6O — CID 135736398
2,6-dibromo-4-[(E)-(2H-tetrazol-5-ylhydrazinylidene)methyl]phenol (PubChem CID 135736398) has the molecular formula C8H6Br2N6O and a molecular weight of 361.99 g/mol. Its IUPAC name is 2,6-dibromo-4-[(E)-(2H-tetrazol-5-ylhydrazinylidene)methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(E)-(2H-tetrazol-5-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 135736398 |
| Molecular Formula | C8H6Br2N6O |
| Molecular Weight | 361.99 g/mol |
| Exact Mass | 359.90 |
| IUPAC Name | 2,6-dibromo-4-[(E)-(2H-tetrazol-5-ylhydrazinylidene)methyl]phenol |
| SMILES | Oc1c(Br)cc(/C=N/Nc2nn[nH]n2)cc1Br |
| InChI | InChI=1S/C8H6Br2N6O/c9-5-1-4(2-6(10)7(5)17)3-11-12-8-13-15-16-14-8/h1-3,17H,(H2,12,13,14,15,16)/b11-3+ |
| InChIKey | CKZDWLJGPRACOW-QDEBKDIKSA-N |
| XLogP | 1.88 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.99 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|