C19H20ClN7O — CID 135531648
2-[(E)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-chlorophenol (PubChem CID 135531648) has the molecular formula C19H20ClN7O and a molecular weight of 397.87 g/mol. Its IUPAC name is 2-[(E)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-chlorophenol.
| Compound Name | 2-[(E)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-chlorophenol |
|---|---|
| PubChem CID | 135531648 |
| Molecular Formula | C19H20ClN7O |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-[(E)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-chlorophenol |
| SMILES | CN(C)c1nc(NCc2ccccc2)nc(N/N=C/c2cc(Cl)ccc2O)n1 |
| InChI | InChI=1S/C19H20ClN7O/c1-27(2)19-24-17(21-11-13-6-4-3-5-7-13)23-18(25-19)26-22-12-14-10-15(20)8-9-16(14)28/h3-10,12,28H,11H2,1-2H3,(H2,21,23,24,25,26)/b22-12+ |
| InChIKey | BFGLCDBDQDOIFF-WSDLNYQXSA-N |
| XLogP | 3.35 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|