C19H21N7O — CID 136691673
2-[[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 136691673) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is 2-[[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-[[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136691673 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-[[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | CN(C)c1nc(NCc2ccccc2)nc(NN=Cc2ccccc2O)n1 |
| InChI | InChI=1S/C19H21N7O/c1-26(2)19-23-17(20-12-14-8-4-3-5-9-14)22-18(24-19)25-21-13-15-10-6-7-11-16(15)27/h3-11,13,27H,12H2,1-2H3,(H2,20,22,23,24,25) |
| InChIKey | CHWZZBPEKZHITF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|